C24H32O8 — CID 154730597
[(1R,2S,4R,5R,6S,8S,10R,12R)-5-[(3aS,5S,6aR)-3a,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]-10-acetyloxy-4,5-dimethylspiro[9-oxatricyclo[6.2.2.01,6]dodecane-12,2'-oxirane]-2-yl] acetate (PubChem CID 154730597) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is [(1R,2S,4R,5R,6S,8S,10R,12R)-5-[(3aS,5S,6aR)-3a,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]-10-acetyloxy-4,5-dimethylspiro[9-oxatricyclo[6.2.2.01,6]dodecane-12,2'-oxirane]-2-yl] acetate.
| Compound Name | [(1R,2S,4R,5R,6S,8S,10R,12R)-5-[(3aS,5S,6aR)-3a,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]-10-acetyloxy-4,5-dimethylspiro[9-oxatricyclo[6.2.2.01,6]dodecane-12,2'-oxirane]-2-yl] acetate |
|---|---|
| PubChem CID | 154730597 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [(1R,2S,4R,5R,6S,8S,10R,12R)-5-[(3aS,5S,6aR)-3a,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]-10-acetyloxy-4,5-dimethylspiro[9-oxatricyclo[6.2.2.01,6]dodecane-12,2'-oxirane]-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@H]2C[C@H]3[C@](C)([C@@H]4C[C@H]5C=CO[C@@H]5O4)[C@H](C)C[C@H](OC(C)=O)[C@]13C[C@@]21CO1 |
| InChI | InChI=1S/C24H32O8/c1-12-7-19(29-13(2)25)24-10-23(11-28-23)18(32-21(24)30-14(3)26)9-16(24)22(12,4)17-8-15-5-6-27-20(15)31-17/h5-6,12,15-21H,7-11H2,1-4H3/t12-,15-,16+,17+,18+,19+,20-,21+,22-,23-,24-/m1/s1 |
| InChIKey | WTYIIHXJPVYTFC-CXWWLVPMSA-N |
| XLogP | 2.69 |
| TPSA | 92.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|