C23H30O8 — CID 162874331
[(1R,2S,5S,6R,8R,10R,11R)-5-[(3aS,5S,6aS)-3a,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]-10-acetyloxy-5-methylspiro[9-oxatricyclo[6.2.2.01,6]dodecane-11,2'-oxirane]-2-yl] acetate (PubChem CID 162874331) has the molecular formula C23H30O8 and a molecular weight of 434.49 g/mol. Its IUPAC name is [(1R,2S,5S,6R,8R,10R,11R)-5-[(3aS,5S,6aS)-3a,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]-10-acetyloxy-5-methylspiro[9-oxatricyclo[6.2.2.01,6]dodecane-11,2'-oxirane]-2-yl] acetate.
| Compound Name | [(1R,2S,5S,6R,8R,10R,11R)-5-[(3aS,5S,6aS)-3a,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]-10-acetyloxy-5-methylspiro[9-oxatricyclo[6.2.2.01,6]dodecane-11,2'-oxirane]-2-yl] acetate |
|---|---|
| PubChem CID | 162874331 |
| Molecular Formula | C23H30O8 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | [(1R,2S,5S,6R,8R,10R,11R)-5-[(3aS,5S,6aS)-3a,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]-10-acetyloxy-5-methylspiro[9-oxatricyclo[6.2.2.01,6]dodecane-11,2'-oxirane]-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@@H]2C[C@@H]3[C@@](C)([C@@H]4C[C@H]5C=CO[C@H]5O4)CC[C@H](OC(C)=O)[C@]13[C@@]1(CO1)C2 |
| InChI | InChI=1S/C23H30O8/c1-12(24)28-17-4-6-21(3,18-8-14-5-7-26-19(14)31-18)16-9-15-10-22(11-27-22)23(16,17)20(30-15)29-13(2)25/h5,7,14-20H,4,6,8-11H2,1-3H3/t14-,15-,16-,17+,18+,19+,20+,21+,22+,23+/m1/s1 |
| InChIKey | OGTLMHPRRNRHPI-LMMUITBASA-N |
| XLogP | 2.45 |
| TPSA | 92.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|