C24H26N2O4S — CID 139073530
(11R,15R)-8,16,16-trimethyl-13-(4-methylphenyl)sulfonyl-17-oxa-8,13-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6-tetraen-9-one (PubChem CID 139073530) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is (11R,15R)-8,16,16-trimethyl-13-(4-methylphenyl)sulfonyl-17-oxa-8,13-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6-tetraen-9-one.
| Compound Name | (11R,15R)-8,16,16-trimethyl-13-(4-methylphenyl)sulfonyl-17-oxa-8,13-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6-tetraen-9-one |
|---|---|
| PubChem CID | 139073530 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (11R,15R)-8,16,16-trimethyl-13-(4-methylphenyl)sulfonyl-17-oxa-8,13-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6-tetraen-9-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]3c4c(c5ccccc5n(C)c4=O)OC(C)(C)[C@H]3C2)cc1 |
| InChI | InChI=1S/C24H26N2O4S/c1-15-9-11-16(12-10-15)31(28,29)26-13-18-19(14-26)24(2,3)30-22-17-7-5-6-8-20(17)25(4)23(27)21(18)22/h5-12,18-19H,13-14H2,1-4H3/t18-,19+/m1/s1 |
| InChIKey | ULJFKVBUSRNEJL-MOPGFXCFSA-N |
| XLogP | 3.42 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |