About (4-bromo-2,6-dimethylphenyl)azanium;bromide;hydrate
(4-bromo-2,6-dimethylphenyl)azanium;bromide;hydrate (PubChem CID 139074068) has the molecular formula C8H13Br2NO
and a molecular weight of 299.01 g/mol. Its IUPAC name is (4-bromo-2,6-dimethylphenyl)azanium;bromide;hydrate.
Molecular Properties
| Compound Name | (4-bromo-2,6-dimethylphenyl)azanium;bromide;hydrate |
| PubChem CID | 139074068 |
| Molecular Formula | C8H13Br2NO |
| Molecular Weight | 299.01 g/mol |
| Exact Mass | 296.94 |
| IUPAC Name | (4-bromo-2,6-dimethylphenyl)azanium;bromide;hydrate |
| SMILES | Cc1cc(Br)cc(C)c1[NH3+].O.[Br-] |
| InChI | InChI=1S/C8H10BrN.BrH.H2O/c1-5-3-7(9)4-6(2)8(5)10;;/h3-4H,10H2,1-2H3;1H;1H2 |
| InChIKey | TZYDJZCUVIRSCP-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.01 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (4-bromo-2,6-dimethylphenyl)azanium;bromide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2,6-dimethylphenyl)azanium;bromide;hydrate?
The IUPAC name of (4-bromo-2,6-dimethylphenyl)azanium;bromide;hydrate (CID 139074068) is (4-bromo-2,6-dimethylphenyl)azanium;bromide;hydrate.
What is the SMILES notation for (4-bromo-2,6-dimethylphenyl)azanium;bromide;hydrate?
The canonical SMILES for (4-bromo-2,6-dimethylphenyl)azanium;bromide;hydrate is Cc1cc(Br)cc(C)c1[NH3+].O.[Br-].
What is the InChIKey of (4-bromo-2,6-dimethylphenyl)azanium;bromide;hydrate?
The InChIKey is TZYDJZCUVIRSCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrN.BrH.H2O/c1-5-3-7(9)4-6(2)8(5)10;;/h3-4H,10H2,1-2H3;1H;1H2.
What are the key properties of (4-bromo-2,6-dimethylphenyl)azanium;bromide;hydrate?
(4-bromo-2,6-dimethylphenyl)azanium;bromide;hydrate has a molecular weight of 299.01 g/mol, XLogP of -1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2,6-dimethylphenyl)azanium;bromide;hydrate is sourced from PubChem (CID 139074068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).