C9H18N4O4 — CID 139075184
N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylmethanimidamide;dihydrate (PubChem CID 139075184) has the molecular formula C9H18N4O4 and a molecular weight of 246.27 g/mol. Its IUPAC name is N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylmethanimidamide;dihydrate.
| Compound Name | N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylmethanimidamide;dihydrate |
|---|---|
| PubChem CID | 139075184 |
| Molecular Formula | C9H18N4O4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylmethanimidamide;dihydrate |
| SMILES | CN(C)/C=N/c1cc(=O)n(C)c(=O)n1C.O.O |
| InChI | InChI=1S/C9H14N4O2.2H2O/c1-11(2)6-10-7-5-8(14)13(4)9(15)12(7)3;;/h5-6H,1-4H3;2*1H2/b10-6+;; |
| InChIKey | SIKGAQIRDDBHMP-DOLBFOAYSA-N |
| XLogP | -2.34 |
| TPSA | 122.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|