C10H16N4O2 — CID 10632909
N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide (PubChem CID 10632909) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide.
| Compound Name | N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 10632909 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide |
| SMILES | C/C(=N\c1cc(=O)n(C)c(=O)n1C)N(C)C |
| InChI | InChI=1S/C10H16N4O2/c1-7(12(2)3)11-8-6-9(15)14(5)10(16)13(8)4/h6H,1-5H3/b11-7+ |
| InChIKey | UZPGEDSDBCJCFG-YRNVUSSQSA-N |
| XLogP | -0.30 |
| TPSA | 59.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|