C12H20N4O2 — CID 23588609
N'-(1-butyl-3-methyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylmethanimidamide (PubChem CID 23588609) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is N'-(1-butyl-3-methyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(1-butyl-3-methyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 23588609 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N'-(1-butyl-3-methyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylmethanimidamide |
| SMILES | CCCCn1c(=O)cc(/N=C/N(C)C)n(C)c1=O |
| InChI | InChI=1S/C12H20N4O2/c1-5-6-7-16-11(17)8-10(13-9-14(2)3)15(4)12(16)18/h8-9H,5-7H2,1-4H3/b13-9+ |
| InChIKey | CJCDBWPEAXBTCS-UKTHLTGXSA-N |
| XLogP | 0.57 |
| TPSA | 59.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|