C17H21ClN2O2 — CID 139079141
1-[(4R,5S,6R)-6-hydroxy-3,6-dimethyl-4-phenyl-2,4,5,7-tetrahydroindazol-1-ium-5-yl]ethanone chloride (PubChem CID 139079141) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is 1-[(4R,5S,6R)-6-hydroxy-3,6-dimethyl-4-phenyl-2,4,5,7-tetrahydroindazol-1-ium-5-yl]ethanone chloride.
| Compound Name | 1-[(4R,5S,6R)-6-hydroxy-3,6-dimethyl-4-phenyl-2,4,5,7-tetrahydroindazol-1-ium-5-yl]ethanone chloride |
|---|---|
| PubChem CID | 139079141 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-[(4R,5S,6R)-6-hydroxy-3,6-dimethyl-4-phenyl-2,4,5,7-tetrahydroindazol-1-ium-5-yl]ethanone chloride |
| SMILES | CC(=O)[C@H]1[C@H](c2ccccc2)c2c(C)[nH][nH+]c2C[C@@]1(C)O.[Cl-] |
| InChI | InChI=1S/C17H20N2O2.ClH/c1-10-14-13(19-18-10)9-17(3,21)16(11(2)20)15(14)12-7-5-4-6-8-12;/h4-8,15-16,21H,9H2,1-3H3,(H,18,19);1H/t15-,16+,17-;/m1./s1 |
| InChIKey | SCHPYMBWYBJVSO-UNLWNTODSA-N |
| XLogP | -1.21 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |