C17H20N2O2 — CID 838672
1-[(4S,5R,6S)-6-hydroxy-3,6-dimethyl-4-phenyl-2,4,5,7-tetrahydroindazol-5-yl]ethanone (PubChem CID 838672) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-[(4S,5R,6S)-6-hydroxy-3,6-dimethyl-4-phenyl-2,4,5,7-tetrahydroindazol-5-yl]ethanone.
| Compound Name | 1-[(4S,5R,6S)-6-hydroxy-3,6-dimethyl-4-phenyl-2,4,5,7-tetrahydroindazol-5-yl]ethanone |
|---|---|
| PubChem CID | 838672 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-[(4S,5R,6S)-6-hydroxy-3,6-dimethyl-4-phenyl-2,4,5,7-tetrahydroindazol-5-yl]ethanone |
| SMILES | CC(=O)[C@@H]1[C@@H](c2ccccc2)c2c(n[nH]c2C)C[C@]1(C)O |
| InChI | InChI=1S/C17H20N2O2/c1-10-14-13(19-18-10)9-17(3,21)16(11(2)20)15(14)12-7-5-4-6-8-12/h4-8,15-16,21H,9H2,1-3H3,(H,18,19)/t15-,16+,17-/m0/s1 |
| InChIKey | XNIRGPLNIOMGAR-BBWFWOEESA-N |
| XLogP | 2.36 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |