C22H24ClNO5S — CID 139080569
4-chlorobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium;hydrate (PubChem CID 139080569) has the molecular formula C22H24ClNO5S and a molecular weight of 449.96 g/mol. Its IUPAC name is 4-chlorobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium;hydrate.
| Compound Name | 4-chlorobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium;hydrate |
|---|---|
| PubChem CID | 139080569 |
| Molecular Formula | C22H24ClNO5S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 4-chlorobenzenesulfonate;2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1-methylpyridin-1-ium;hydrate |
| SMILES | CCOc1ccc(/C=C/c2cccc[n+]2C)cc1.O.O=S(=O)([O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H18NO.C6H5ClO3S.H2O/c1-3-18-16-11-8-14(9-12-16)7-10-15-6-4-5-13-17(15)2;7-5-1-3-6(4-2-5)11(8,9)10;/h4-13H,3H2,1-2H3;1-4H,(H,8,9,10);1H2/q+1;;/p-1/b10-7+;; |
| InChIKey | XCKKFLOTBLBHOA-WRQJSNHTSA-M |
| XLogP | 3.50 |
| TPSA | 101.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|