C20H26NO3+ — CID 20532551
2-[(E)-2-[4-(2,2-diethoxyethoxy)phenyl]ethenyl]-1-methylpyridin-1-ium (PubChem CID 20532551) has the molecular formula C20H26NO3+ and a molecular weight of 328.43 g/mol. Its IUPAC name is 2-[(E)-2-[4-(2,2-diethoxyethoxy)phenyl]ethenyl]-1-methylpyridin-1-ium.
| Compound Name | 2-[(E)-2-[4-(2,2-diethoxyethoxy)phenyl]ethenyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 20532551 |
| Molecular Formula | C20H26NO3+ |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-[(E)-2-[4-(2,2-diethoxyethoxy)phenyl]ethenyl]-1-methylpyridin-1-ium |
| SMILES | CCOC(COc1ccc(/C=C/c2cccc[n+]2C)cc1)OCC |
| InChI | InChI=1S/C20H26NO3/c1-4-22-20(23-5-2)16-24-19-13-10-17(11-14-19)9-12-18-8-6-7-15-21(18)3/h6-15,20H,4-5,16H2,1-3H3/q+1/b12-9+ |
| InChIKey | SRHSNCBFAGTACP-FMIVXFBMSA-N |
| XLogP | 3.46 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|