C18H24NO3S+ — CID 67827157
4-[(Z)-2-[2-(2,2-diethoxyethoxy)phenyl]ethenyl]-3-methyl-1,3-thiazol-3-ium (PubChem CID 67827157) has the molecular formula C18H24NO3S+ and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-[(Z)-2-[2-(2,2-diethoxyethoxy)phenyl]ethenyl]-3-methyl-1,3-thiazol-3-ium.
| Compound Name | 4-[(Z)-2-[2-(2,2-diethoxyethoxy)phenyl]ethenyl]-3-methyl-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 67827157 |
| Molecular Formula | C18H24NO3S+ |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 4-[(Z)-2-[2-(2,2-diethoxyethoxy)phenyl]ethenyl]-3-methyl-1,3-thiazol-3-ium |
| SMILES | CCOC(COc1ccccc1/C=C\c1csc[n+]1C)OCC |
| InChI | InChI=1S/C18H24NO3S/c1-4-20-18(21-5-2)12-22-17-9-7-6-8-15(17)10-11-16-13-23-14-19(16)3/h6-11,13-14,18H,4-5,12H2,1-3H3/q+1/b11-10- |
| InChIKey | VVEMKQITXPZGAC-KHPPLWFESA-N |
| XLogP | 3.52 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|