C24H29ClN2O4S — CID 139081872
4-chlorobenzenesulfonate;N,N-diethyl-4-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]aniline;hydrate (PubChem CID 139081872) has the molecular formula C24H29ClN2O4S and a molecular weight of 477.03 g/mol. Its IUPAC name is 4-chlorobenzenesulfonate;N,N-diethyl-4-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]aniline;hydrate.
| Compound Name | 4-chlorobenzenesulfonate;N,N-diethyl-4-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]aniline;hydrate |
|---|---|
| PubChem CID | 139081872 |
| Molecular Formula | C24H29ClN2O4S |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 4-chlorobenzenesulfonate;N,N-diethyl-4-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]aniline;hydrate |
| SMILES | CCN(CC)c1ccc(/C=C/c2cccc[n+]2C)cc1.O.O=S(=O)([O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H23N2.C6H5ClO3S.H2O/c1-4-20(5-2)18-13-10-16(11-14-18)9-12-17-8-6-7-15-19(17)3;7-5-1-3-6(4-2-5)11(8,9)10;/h6-15H,4-5H2,1-3H3;1-4H,(H,8,9,10);1H2/q+1;;/p-1 |
| InChIKey | PCQLIACLDBNMDI-UHFFFAOYSA-M |
| XLogP | 3.95 |
| TPSA | 95.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|