C52H64N8O8 — CID 139081444
ethyl 1-(2-morpholin-4-ylethyl)-2-(4-morpholin-4-ylphenyl)benzimidazole-5-carboxylate (PubChem CID 139081444) has the molecular formula C52H64N8O8 and a molecular weight of 929.13 g/mol. Its IUPAC name is ethyl 1-(2-morpholin-4-ylethyl)-2-(4-morpholin-4-ylphenyl)benzimidazole-5-carboxylate.
| Compound Name | ethyl 1-(2-morpholin-4-ylethyl)-2-(4-morpholin-4-ylphenyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 139081444 |
| Molecular Formula | C52H64N8O8 |
| Molecular Weight | 929.13 g/mol |
| Exact Mass | 928.48 |
| IUPAC Name | ethyl 1-(2-morpholin-4-ylethyl)-2-(4-morpholin-4-ylphenyl)benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(-c1ccc(N3CCOCC3)cc1)n2CCN1CCOCC1.CCOC(=O)c1ccc2c(c1)nc(-c1ccc(N3CCOCC3)cc1)n2CCN1CCOCC1 |
| InChI | InChI=1S/2C26H32N4O4/c2*1-2-34-26(31)21-5-8-24-23(19-21)27-25(30(24)10-9-28-11-15-32-16-12-28)20-3-6-22(7-4-20)29-13-17-33-18-14-29/h2*3-8,19H,2,9-18H2,1H3 |
| InChIKey | SLEZLLSJCJTCBS-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 138.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.13 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|