C10H23ClN3O2P — CID 139082312
N-bis(tert-butylamino)phosphoryl-2-chloroacetamide (PubChem CID 139082312) has the molecular formula C10H23ClN3O2P and a molecular weight of 283.74 g/mol. Its IUPAC name is N-bis(tert-butylamino)phosphoryl-2-chloroacetamide.
| Compound Name | N-bis(tert-butylamino)phosphoryl-2-chloroacetamide |
|---|---|
| PubChem CID | 139082312 |
| Molecular Formula | C10H23ClN3O2P |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-bis(tert-butylamino)phosphoryl-2-chloroacetamide |
| SMILES | CC(C)(C)NP(=O)(NC(=O)CCl)NC(C)(C)C |
| InChI | InChI=1S/C10H23ClN3O2P/c1-9(2,3)13-17(16,12-8(15)7-11)14-10(4,5)6/h7H2,1-6H3,(H3,12,13,14,15,16) |
| InChIKey | QCIZRAFKRMYAFH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|