About piperazine-1,4-diium diacetate
piperazine-1,4-diium diacetate (PubChem CID 139082665) has the molecular formula C8H18N2O4
and a molecular weight of 206.24 g/mol. Its IUPAC name is piperazine-1,4-diium diacetate.
Molecular Properties
| Compound Name | piperazine-1,4-diium diacetate |
| PubChem CID | 139082665 |
| Molecular Formula | C8H18N2O4 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | piperazine-1,4-diium diacetate |
| SMILES | C1C[NH2+]CC[NH2+]1.CC(=O)[O-].CC(=O)[O-] |
| InChI | InChI=1S/C4H10N2.2C2H4O2/c1-2-6-4-3-5-1;2*1-2(3)4/h5-6H,1-4H2;2*1H3,(H,3,4) |
| InChIKey | QLNXEIHDVAGZKV-UHFFFAOYSA-N |
| XLogP | -5.36 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazine-1,4-diium diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine-1,4-diium diacetate?
The IUPAC name of piperazine-1,4-diium diacetate (CID 139082665) is piperazine-1,4-diium diacetate.
What is the SMILES notation for piperazine-1,4-diium diacetate?
The canonical SMILES for piperazine-1,4-diium diacetate is C1C[NH2+]CC[NH2+]1.CC(=O)[O-].CC(=O)[O-].
What is the InChIKey of piperazine-1,4-diium diacetate?
The InChIKey is QLNXEIHDVAGZKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2.2C2H4O2/c1-2-6-4-3-5-1;2*1-2(3)4/h5-6H,1-4H2;2*1H3,(H,3,4).
What are the key properties of piperazine-1,4-diium diacetate?
piperazine-1,4-diium diacetate has a molecular weight of 206.24 g/mol, XLogP of -5.36, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine-1,4-diium diacetate is sourced from PubChem (CID 139082665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).