C46H34F6N4O4 — CID 139083809
ethyl 1-phenyl-2-[4-(trifluoromethyl)phenyl]benzimidazole-5-carboxylate (PubChem CID 139083809) has the molecular formula C46H34F6N4O4 and a molecular weight of 820.79 g/mol. Its IUPAC name is ethyl 1-phenyl-2-[4-(trifluoromethyl)phenyl]benzimidazole-5-carboxylate.
| Compound Name | ethyl 1-phenyl-2-[4-(trifluoromethyl)phenyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 139083809 |
| Molecular Formula | C46H34F6N4O4 |
| Molecular Weight | 820.79 g/mol |
| Exact Mass | 820.25 |
| IUPAC Name | ethyl 1-phenyl-2-[4-(trifluoromethyl)phenyl]benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(-c1ccc(C(F)(F)F)cc1)n2-c1ccccc1.CCOC(=O)c1ccc2c(c1)nc(-c1ccc(C(F)(F)F)cc1)n2-c1ccccc1 |
| InChI | InChI=1S/2C23H17F3N2O2/c2*1-2-30-22(29)16-10-13-20-19(14-16)27-21(28(20)18-6-4-3-5-7-18)15-8-11-17(12-9-15)23(24,25)26/h2*3-14H,2H2,1H3 |
| InChIKey | AWXCGFYQPZERKF-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.79 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |