C20H19Cl2N5O2S — CID 139084026
4-chloro-N-[1-[2-[(4-chlorobenzoyl)carbamothioylamino]ethyl]-4,5-dihydroimidazol-2-yl]benzamide (PubChem CID 139084026) has the molecular formula C20H19Cl2N5O2S and a molecular weight of 464.38 g/mol. Its IUPAC name is 4-chloro-N-[1-[2-[(4-chlorobenzoyl)carbamothioylamino]ethyl]-4,5-dihydroimidazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[2-[(4-chlorobenzoyl)carbamothioylamino]ethyl]-4,5-dihydroimidazol-2-yl]benzamide |
|---|---|
| PubChem CID | 139084026 |
| Molecular Formula | C20H19Cl2N5O2S |
| Molecular Weight | 464.38 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 4-chloro-N-[1-[2-[(4-chlorobenzoyl)carbamothioylamino]ethyl]-4,5-dihydroimidazol-2-yl]benzamide |
| SMILES | O=C(NC(=S)NCCN1CCN=C1NC(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19Cl2N5O2S/c21-15-5-1-13(2-6-15)17(28)25-19-23-9-11-27(19)12-10-24-20(30)26-18(29)14-3-7-16(22)8-4-14/h1-8H,9-12H2,(H,23,25,28)(H2,24,26,29,30) |
| InChIKey | JCOYQKQSAQDYRO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|