C22H22MnN2O4 — CID 139086176
manganese(2+);bis((Z)-4-oxopent-2-en-2-olate);1,10-phenanthroline (PubChem CID 139086176) has the molecular formula C22H22MnN2O4 and a molecular weight of 433.37 g/mol. Its IUPAC name is manganese(2+);bis((Z)-4-oxopent-2-en-2-olate);1,10-phenanthroline.
| Compound Name | manganese(2+);bis((Z)-4-oxopent-2-en-2-olate);1,10-phenanthroline |
|---|---|
| PubChem CID | 139086176 |
| Molecular Formula | C22H22MnN2O4 |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | manganese(2+);bis((Z)-4-oxopent-2-en-2-olate);1,10-phenanthroline |
| SMILES | CC(=O)/C=C(/C)[O-].CC(=O)/C=C(/C)[O-].[Mn+2].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.2C5H8O2.Mn/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2*1-4(6)3-5(2)7;/h1-8H;2*3,6H,1-2H3;/q;;;+2/p-2/b;2*4-3-; |
| InChIKey | VNPYPIGXSCDEMB-QDMRRLORSA-L |
| XLogP | 2.46 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|