C32H26N4O14 — CID 139087948
N,N'-bis(pyridin-1-ium-2-ylmethyl)oxamide;bis(3,5-dicarboxybenzoate) (PubChem CID 139087948) has the molecular formula C32H26N4O14 and a molecular weight of 690.57 g/mol. Its IUPAC name is N,N'-bis(pyridin-1-ium-2-ylmethyl)oxamide;bis(3,5-dicarboxybenzoate).
| Compound Name | N,N'-bis(pyridin-1-ium-2-ylmethyl)oxamide;bis(3,5-dicarboxybenzoate) |
|---|---|
| PubChem CID | 139087948 |
| Molecular Formula | C32H26N4O14 |
| Molecular Weight | 690.57 g/mol |
| Exact Mass | 690.14 |
| IUPAC Name | N,N'-bis(pyridin-1-ium-2-ylmethyl)oxamide;bis(3,5-dicarboxybenzoate) |
| SMILES | O=C(NCc1cccc[nH+]1)C(=O)NCc1cccc[nH+]1.O=C([O-])c1cc(C(=O)O)cc(C(=O)O)c1.O=C([O-])c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C14H14N4O2.2C9H6O6/c19-13(17-9-11-5-1-3-7-15-11)14(20)18-10-12-6-2-4-8-16-12;2*10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-8H,9-10H2,(H,17,19)(H,18,20);2*1-3H,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | CSQGZUNILFCDRO-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 315.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.57 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|