C27H32ClN5O3 — CID 139088219
5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-4-ium-1-yl]-1-benzofuran-2-carboxamide;methanol;chloride (PubChem CID 139088219) has the molecular formula C27H32ClN5O3 and a molecular weight of 510.04 g/mol. Its IUPAC name is 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-4-ium-1-yl]-1-benzofuran-2-carboxamide;methanol;chloride.
| Compound Name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-4-ium-1-yl]-1-benzofuran-2-carboxamide;methanol;chloride |
|---|---|
| PubChem CID | 139088219 |
| Molecular Formula | C27H32ClN5O3 |
| Molecular Weight | 510.04 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-4-ium-1-yl]-1-benzofuran-2-carboxamide;methanol;chloride |
| SMILES | CO.N#Cc1ccc2[nH]cc(CCCC[NH+]3CCN(c4ccc5oc(C(N)=O)cc5c4)CC3)c2c1.[Cl-] |
| InChI | InChI=1S/C26H27N5O2.CH4O.ClH/c27-16-18-4-6-23-22(13-18)19(17-29-23)3-1-2-8-30-9-11-31(12-10-30)21-5-7-24-20(14-21)15-25(33-24)26(28)32;1-2;/h4-7,13-15,17,29H,1-3,8-12H2,(H2,28,32);2H,1H3;1H |
| InChIKey | ASQMKPSLFYKMMM-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 123.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.04 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|