C27H27ClN2O4 — CID 139089604
(5S,6R)-3-[(2S,3S)-2-benzyl-3-(4-chlorophenyl)-3-hydroxypropanoyl]-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinan-2-one (PubChem CID 139089604) has the molecular formula C27H27ClN2O4 and a molecular weight of 478.98 g/mol. Its IUPAC name is (5S,6R)-3-[(2S,3S)-2-benzyl-3-(4-chlorophenyl)-3-hydroxypropanoyl]-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinan-2-one.
| Compound Name | (5S,6R)-3-[(2S,3S)-2-benzyl-3-(4-chlorophenyl)-3-hydroxypropanoyl]-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinan-2-one |
|---|---|
| PubChem CID | 139089604 |
| Molecular Formula | C27H27ClN2O4 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | (5S,6R)-3-[(2S,3S)-2-benzyl-3-(4-chlorophenyl)-3-hydroxypropanoyl]-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinan-2-one |
| SMILES | C[C@H]1[C@@H](c2ccccc2)OC(=O)N(C(=O)[C@@H](Cc2ccccc2)[C@H](O)c2ccc(Cl)cc2)N1C |
| InChI | InChI=1S/C27H27ClN2O4/c1-18-25(21-11-7-4-8-12-21)34-27(33)30(29(18)2)26(32)23(17-19-9-5-3-6-10-19)24(31)20-13-15-22(28)16-14-20/h3-16,18,23-25,31H,17H2,1-2H3/t18-,23-,24+,25-/m0/s1 |
| InChIKey | NDIFFZLSGAWYQI-TZAMREQXSA-N |
| XLogP | 5.19 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |