C19H19NO4 — CID 139089922
anthracen-9-ylmethyl(dimethyl)azanium;2-hydroxy-2-oxoacetate (PubChem CID 139089922) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is anthracen-9-ylmethyl(dimethyl)azanium;2-hydroxy-2-oxoacetate.
| Compound Name | anthracen-9-ylmethyl(dimethyl)azanium;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 139089922 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | anthracen-9-ylmethyl(dimethyl)azanium;2-hydroxy-2-oxoacetate |
| SMILES | C[NH+](C)Cc1c2ccccc2cc2ccccc12.O=C([O-])C(=O)O |
| InChI | InChI=1S/C17H17N.C2H2O4/c1-18(2)12-17-15-9-5-3-7-13(15)11-14-8-4-6-10-16(14)17;3-1(4)2(5)6/h3-11H,12H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | WSYINKVQTDCSQE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 81.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|