C27H38O5S — CID 139090282
methyl (1R,2S,4S,7E,11S)-7,11-dimethyl-3,13-dioxo-2-[(R)-phenylsulfinyl]-4-propan-2-ylcyclotetradec-7-ene-1-carboxylate (PubChem CID 139090282) has the molecular formula C27H38O5S and a molecular weight of 474.66 g/mol. Its IUPAC name is methyl (1R,2S,4S,7E,11S)-7,11-dimethyl-3,13-dioxo-2-[(R)-phenylsulfinyl]-4-propan-2-ylcyclotetradec-7-ene-1-carboxylate.
| Compound Name | methyl (1R,2S,4S,7E,11S)-7,11-dimethyl-3,13-dioxo-2-[(R)-phenylsulfinyl]-4-propan-2-ylcyclotetradec-7-ene-1-carboxylate |
|---|---|
| PubChem CID | 139090282 |
| Molecular Formula | C27H38O5S |
| Molecular Weight | 474.66 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | methyl (1R,2S,4S,7E,11S)-7,11-dimethyl-3,13-dioxo-2-[(R)-phenylsulfinyl]-4-propan-2-ylcyclotetradec-7-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC(=O)C[C@@H](C)CC/C=C(\C)CC[C@@H](C(C)C)C(=O)[C@H]1[S@@](=O)c1ccccc1 |
| InChI | InChI=1S/C27H38O5S/c1-18(2)23-15-14-19(3)10-9-11-20(4)16-21(28)17-24(27(30)32-5)26(25(23)29)33(31)22-12-7-6-8-13-22/h6-8,10,12-13,18,20,23-24,26H,9,11,14-17H2,1-5H3/b19-10+/t20-,23-,24-,26-,33-/m0/s1 |
| InChIKey | YLNQLFZDDRUOLA-FIOCXSINSA-N |
| XLogP | 5.30 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.66 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|