C30H38N6O2 — CID 139091981
(NE)-N-[[1,8-bis(dimethylamino)naphthalen-2-yl]methylidene]hydroxylamine (PubChem CID 139091981) has the molecular formula C30H38N6O2 and a molecular weight of 514.67 g/mol. Its IUPAC name is (NE)-N-[[1,8-bis(dimethylamino)naphthalen-2-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[1,8-bis(dimethylamino)naphthalen-2-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 139091981 |
| Molecular Formula | C30H38N6O2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | (NE)-N-[[1,8-bis(dimethylamino)naphthalen-2-yl]methylidene]hydroxylamine |
| SMILES | CN(C)c1cccc2ccc(/C=N/O)c(N(C)C)c12.CN(C)c1cccc2ccc(/C=N/O)c(N(C)C)c12 |
| InChI | InChI=1S/2C15H19N3O/c2*1-17(2)13-7-5-6-11-8-9-12(10-16-19)15(14(11)13)18(3)4/h2*5-10,19H,1-4H3/b2*16-10+ |
| InChIKey | UKONQIFRYMOQGT-UDGBXGIMSA-N |
| XLogP | 5.56 |
| TPSA | 78.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|