C17H21N3O2 — CID 177405038
1-N,1-N,8-N,8-N-tetramethyl-2-[(Z)-2-nitroprop-1-enyl]naphthalene-1,8-diamine (PubChem CID 177405038) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-N,1-N,8-N,8-N-tetramethyl-2-[(Z)-2-nitroprop-1-enyl]naphthalene-1,8-diamine.
| Compound Name | 1-N,1-N,8-N,8-N-tetramethyl-2-[(Z)-2-nitroprop-1-enyl]naphthalene-1,8-diamine |
|---|---|
| PubChem CID | 177405038 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-N,1-N,8-N,8-N-tetramethyl-2-[(Z)-2-nitroprop-1-enyl]naphthalene-1,8-diamine |
| SMILES | C/C(=C/c1ccc2cccc(N(C)C)c2c1N(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N3O2/c1-12(20(21)22)11-14-10-9-13-7-6-8-15(18(2)3)16(13)17(14)19(4)5/h6-11H,1-5H3/b12-11- |
| InChIKey | ASJIYXXAZMGKBX-QXMHVHEDSA-N |
| XLogP | 3.61 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|