About bis[8-(dimethylamino)naphthalen-1-yl]-iodotellanium triiodide
bis[8-(dimethylamino)naphthalen-1-yl]-iodotellanium triiodide (PubChem CID 139159619) has the molecular formula C24H24I4N2Te
and a molecular weight of 975.69 g/mol. Its IUPAC name is bis[8-(dimethylamino)naphthalen-1-yl]-iodotellanium triiodide.
Molecular Properties
| Compound Name | bis[8-(dimethylamino)naphthalen-1-yl]-iodotellanium triiodide |
| PubChem CID | 139159619 |
| Molecular Formula | C24H24I4N2Te |
| Molecular Weight | 975.69 g/mol |
| Exact Mass | 977.72 |
| IUPAC Name | bis[8-(dimethylamino)naphthalen-1-yl]-iodotellanium triiodide |
| SMILES | CN(C)c1cccc2cccc([Te+](I)c3cccc4cccc(N(C)C)c34)c12.I[I-]I |
| InChI | InChI=1S/C24H24IN2Te.I3/c1-26(2)19-13-5-9-17-11-7-15-21(23(17)19)28(25)22-16-8-12-18-10-6-14-20(24(18)22)27(3)4;1-3-2/h5-16H,1-4H3;/q+1;-1 |
| InChIKey | LLOZXOFCPRPTIK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 975.69 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze bis[8-(dimethylamino)naphthalen-1-yl]-iodotellanium triiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[8-(dimethylamino)naphthalen-1-yl]-iodotellanium triiodide?
The IUPAC name of bis[8-(dimethylamino)naphthalen-1-yl]-iodotellanium triiodide (CID 139159619) is bis[8-(dimethylamino)naphthalen-1-yl]-iodotellanium triiodide.
What is the SMILES notation for bis[8-(dimethylamino)naphthalen-1-yl]-iodotellanium triiodide?
The canonical SMILES for bis[8-(dimethylamino)naphthalen-1-yl]-iodotellanium triiodide is CN(C)c1cccc2cccc([Te+](I)c3cccc4cccc(N(C)C)c34)c12.I[I-]I.
What is the InChIKey of bis[8-(dimethylamino)naphthalen-1-yl]-iodotellanium triiodide?
The InChIKey is LLOZXOFCPRPTIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24IN2Te.I3/c1-26(2)19-13-5-9-17-11-7-15-21(23(17)19)28(25)22-16-8-12-18-10-6-14-20(24(18)22)27(3)4;1-3-2/h5-16H,1-4H3;/q+1;-1.
What are the key properties of bis[8-(dimethylamino)naphthalen-1-yl]-iodotellanium triiodide?
bis[8-(dimethylamino)naphthalen-1-yl]-iodotellanium triiodide has a molecular weight of 975.69 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis[8-(dimethylamino)naphthalen-1-yl]-iodotellanium triiodide is sourced from PubChem (CID 139159619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).