C20H30N4Sn — CID 11282229
bis[2,6-bis(dimethylamino)phenyl]tin (PubChem CID 11282229) has the molecular formula C20H30N4Sn and a molecular weight of 445.20 g/mol. Its IUPAC name is bis[2,6-bis(dimethylamino)phenyl]tin.
| Compound Name | bis[2,6-bis(dimethylamino)phenyl]tin |
|---|---|
| PubChem CID | 11282229 |
| Molecular Formula | C20H30N4Sn |
| Molecular Weight | 445.20 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | bis[2,6-bis(dimethylamino)phenyl]tin |
| SMILES | CN(C)c1cccc(N(C)C)c1[Sn]c1c(N(C)C)cccc1N(C)C |
| InChI | InChI=1S/2C10H15N2.Sn/c2*1-11(2)9-6-5-7-10(8-9)12(3)4;/h2*5-7H,1-4H3; |
| InChIKey | JUPDQVSOHJQBPS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |