C26H33ClN4Sn — CID 166437590
[2,6-bis[2,6-bis(dimethylamino)phenyl]phenyl]-chlorotin (PubChem CID 166437590) has the molecular formula C26H33ClN4Sn and a molecular weight of 555.74 g/mol. Its IUPAC name is [2,6-bis[2,6-bis(dimethylamino)phenyl]phenyl]-chlorotin.
| Compound Name | [2,6-bis[2,6-bis(dimethylamino)phenyl]phenyl]-chlorotin |
|---|---|
| PubChem CID | 166437590 |
| Molecular Formula | C26H33ClN4Sn |
| Molecular Weight | 555.74 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | [2,6-bis[2,6-bis(dimethylamino)phenyl]phenyl]-chlorotin |
| SMILES | CN(C)c1cccc(N(C)C)c1-c1cccc(-c2c(N(C)C)cccc2N(C)C)c1[Sn]Cl |
| InChI | InChI=1S/C26H33N4.ClH.Sn/c1-27(2)21-14-10-15-22(28(3)4)25(21)19-12-9-13-20(18-19)26-23(29(5)6)16-11-17-24(26)30(7)8;;/h9-17H,1-8H3;1H;/q;;+1/p-1 |
| InChIKey | CYGXGMNSKKYFOE-UHFFFAOYSA-M |
| XLogP | 4.77 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.74 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |