C28H26N2Si — CID 101153069
8-[[8-(dimethylamino)naphthalen-1-yl]-diethynylsilyl]-N,N-dimethylnaphthalen-1-amine (PubChem CID 101153069) has the molecular formula C28H26N2Si and a molecular weight of 418.62 g/mol. Its IUPAC name is 8-[[8-(dimethylamino)naphthalen-1-yl]-diethynylsilyl]-N,N-dimethylnaphthalen-1-amine.
| Compound Name | 8-[[8-(dimethylamino)naphthalen-1-yl]-diethynylsilyl]-N,N-dimethylnaphthalen-1-amine |
|---|---|
| PubChem CID | 101153069 |
| Molecular Formula | C28H26N2Si |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 8-[[8-(dimethylamino)naphthalen-1-yl]-diethynylsilyl]-N,N-dimethylnaphthalen-1-amine |
| SMILES | C#C[Si](C#C)(c1cccc2cccc(N(C)C)c12)c1cccc2cccc(N(C)C)c12 |
| InChI | InChI=1S/C28H26N2Si/c1-7-31(8-2,25-19-11-15-21-13-9-17-23(27(21)25)29(3)4)26-20-12-16-22-14-10-18-24(28(22)26)30(5)6/h1-2,9-20H,3-6H3 |
| InChIKey | WFBUEBGXROPSKB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|