C26H28FNSi2 — CID 101142420
8-[fluoro-methyl-[methyl(diphenyl)silyl]silyl]-N,N-dimethylnaphthalen-1-amine (PubChem CID 101142420) has the molecular formula C26H28FNSi2 and a molecular weight of 429.69 g/mol. Its IUPAC name is 8-[fluoro-methyl-[methyl(diphenyl)silyl]silyl]-N,N-dimethylnaphthalen-1-amine.
| Compound Name | 8-[fluoro-methyl-[methyl(diphenyl)silyl]silyl]-N,N-dimethylnaphthalen-1-amine |
|---|---|
| PubChem CID | 101142420 |
| Molecular Formula | C26H28FNSi2 |
| Molecular Weight | 429.69 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 8-[fluoro-methyl-[methyl(diphenyl)silyl]silyl]-N,N-dimethylnaphthalen-1-amine |
| SMILES | CN(C)c1cccc2cccc([Si@@](C)(F)[Si](C)(c3ccccc3)c3ccccc3)c12 |
| InChI | InChI=1S/C26H28FNSi2/c1-28(2)24-19-11-13-21-14-12-20-25(26(21)24)30(4,27)29(3,22-15-7-5-8-16-22)23-17-9-6-10-18-23/h5-20H,1-4H3/t30-/m0/s1 |
| InChIKey | FJLZWDDMFOTOGS-PMERELPUSA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|