C14H17Cl2NSi — CID 101060213
8-[dichloro(ethyl)silyl]-N,N-dimethylnaphthalen-1-amine (PubChem CID 101060213) has the molecular formula C14H17Cl2NSi and a molecular weight of 298.29 g/mol. Its IUPAC name is 8-[dichloro(ethyl)silyl]-N,N-dimethylnaphthalen-1-amine.
| Compound Name | 8-[dichloro(ethyl)silyl]-N,N-dimethylnaphthalen-1-amine |
|---|---|
| PubChem CID | 101060213 |
| Molecular Formula | C14H17Cl2NSi |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 8-[dichloro(ethyl)silyl]-N,N-dimethylnaphthalen-1-amine |
| SMILES | CC[Si](Cl)(Cl)c1cccc2cccc(N(C)C)c12 |
| InChI | InChI=1S/C14H17Cl2NSi/c1-4-18(15,16)13-10-6-8-11-7-5-9-12(14(11)13)17(2)3/h5-10H,4H2,1-3H3 |
| InChIKey | BUSDXUANTJNFQS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|