C14H17NSSe — CID 102252435
8-ethylsulfanylselanyl-N,N-dimethylnaphthalen-1-amine (PubChem CID 102252435) has the molecular formula C14H17NSSe and a molecular weight of 310.32 g/mol. Its IUPAC name is 8-ethylsulfanylselanyl-N,N-dimethylnaphthalen-1-amine.
| Compound Name | 8-ethylsulfanylselanyl-N,N-dimethylnaphthalen-1-amine |
|---|---|
| PubChem CID | 102252435 |
| Molecular Formula | C14H17NSSe |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 8-ethylsulfanylselanyl-N,N-dimethylnaphthalen-1-amine |
| SMILES | CCS[Se]c1cccc2cccc(N(C)C)c12 |
| InChI | InChI=1S/C14H17NSSe/c1-4-16-17-13-10-6-8-11-7-5-9-12(14(11)13)15(2)3/h5-10H,4H2,1-3H3 |
| InChIKey | HIFRZVDNJOIXQS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|