C18H17NOSe — CID 15456274
N,N-dimethyl-8-phenylseleninylnaphthalen-1-amine (PubChem CID 15456274) has the molecular formula C18H17NOSe and a molecular weight of 342.30 g/mol. Its IUPAC name is N,N-dimethyl-8-phenylseleninylnaphthalen-1-amine.
| Compound Name | N,N-dimethyl-8-phenylseleninylnaphthalen-1-amine |
|---|---|
| PubChem CID | 15456274 |
| Molecular Formula | C18H17NOSe |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | N,N-dimethyl-8-phenylseleninylnaphthalen-1-amine |
| SMILES | CN(C)c1cccc2cccc([Se](=O)c3ccccc3)c12 |
| InChI | InChI=1S/C18H17NOSe/c1-19(2)16-12-6-8-14-9-7-13-17(18(14)16)21(20)15-10-4-3-5-11-15/h3-13H,1-2H3 |
| InChIKey | LUEUAZKHTDURKF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|