C42H6Br6F18N12 — CID 139092312
2,9-dibromo-6,13-bis(trifluoromethyl)-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8,10,12,15-octaene (PubChem CID 139092312) has the molecular formula C42H6Br6F18N12 and a molecular weight of 1499.98 g/mol. Its IUPAC name is 2,9-dibromo-6,13-bis(trifluoromethyl)-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8,10,12,15-octaene.
| Compound Name | 2,9-dibromo-6,13-bis(trifluoromethyl)-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8,10,12,15-octaene |
|---|---|
| PubChem CID | 139092312 |
| Molecular Formula | C42H6Br6F18N12 |
| Molecular Weight | 1499.98 g/mol |
| Exact Mass | 1493.57 |
| IUPAC Name | 2,9-dibromo-6,13-bis(trifluoromethyl)-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8,10,12,15-octaene |
| SMILES | FC(F)(F)c1nc2cc(Br)c3nc(C(F)(F)F)nc4cc(Br)c(n1)c2c43.FC(F)(F)c1nc2cc(Br)c3nc(C(F)(F)F)nc4cc(Br)c(n1)c2c43.FC(F)(F)c1nc2cc(Br)c3nc(C(F)(F)F)nc4cc(Br)c(n1)c2c43 |
| InChI | InChI=1S/3C14H2Br2F6N4/c3*15-3-1-5-7-8-6(24-12(14(20,21)22)25-9(3)8)2-4(16)10(7)26-11(23-5)13(17,18)19/h3*1-2H |
| InChIKey | URYUGFHWRVXBTC-UHFFFAOYSA-N |
| XLogP | 17.18 |
| TPSA | 154.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1499.98 |
| LogP ≤ 5 | 17.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|