C21H31NO6S — CID 139094130
dimethyl 2-[(1R,2R)-2-[(E)-N-[(R)-tert-butylsulfinyl]-C-methoxycarbonimidoyl]-1-phenylbutyl]propanedioate (PubChem CID 139094130) has the molecular formula C21H31NO6S and a molecular weight of 425.55 g/mol. Its IUPAC name is dimethyl 2-[(1R,2R)-2-[(E)-N-[(R)-tert-butylsulfinyl]-C-methoxycarbonimidoyl]-1-phenylbutyl]propanedioate.
| Compound Name | dimethyl 2-[(1R,2R)-2-[(E)-N-[(R)-tert-butylsulfinyl]-C-methoxycarbonimidoyl]-1-phenylbutyl]propanedioate |
|---|---|
| PubChem CID | 139094130 |
| Molecular Formula | C21H31NO6S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | dimethyl 2-[(1R,2R)-2-[(E)-N-[(R)-tert-butylsulfinyl]-C-methoxycarbonimidoyl]-1-phenylbutyl]propanedioate |
| SMILES | CC[C@@H](/C(=N\[S@](=O)C(C)(C)C)OC)[C@@H](c1ccccc1)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C21H31NO6S/c1-8-15(18(26-5)22-29(25)21(2,3)4)16(14-12-10-9-11-13-14)17(19(23)27-6)20(24)28-7/h9-13,15-17H,8H2,1-7H3/b22-18+/t15-,16-,29-/m1/s1 |
| InChIKey | BVZVYCGKBXAUMI-DSARTUOSSA-N |
| XLogP | 3.27 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|