C23H29NO4Zn — CID 146163628
zinc;[(1R,2R,3S)-2,3-bis(methoxycarbonyl)-1-phenylpentyl]-phenylazanide;ethane (PubChem CID 146163628) has the molecular formula C23H29NO4Zn and a molecular weight of 448.88 g/mol. Its IUPAC name is zinc;[(1R,2R,3S)-2,3-bis(methoxycarbonyl)-1-phenylpentyl]-phenylazanide;ethane.
| Compound Name | zinc;[(1R,2R,3S)-2,3-bis(methoxycarbonyl)-1-phenylpentyl]-phenylazanide;ethane |
|---|---|
| PubChem CID | 146163628 |
| Molecular Formula | C23H29NO4Zn |
| Molecular Weight | 448.88 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | zinc;[(1R,2R,3S)-2,3-bis(methoxycarbonyl)-1-phenylpentyl]-phenylazanide;ethane |
| SMILES | CC[C@H](C(=O)OC)[C@@H](C(=O)OC)[C@@H]([N-]c1ccccc1)c1ccccc1.[CH2-]C.[Zn+2] |
| InChI | InChI=1S/C21H24NO4.C2H5.Zn/c1-4-17(20(23)25-2)18(21(24)26-3)19(15-11-7-5-8-12-15)22-16-13-9-6-10-14-16;1-2;/h5-14,17-19H,4H2,1-3H3;1H2,2H3;/q2*-1;+2/t17-,18+,19-;;/m0../s1 |
| InChIKey | HLKIGAHTSYKCLY-SNHXZJKFSA-N |
| XLogP | 5.26 |
| TPSA | 66.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.88 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|