C27H39NZr+2 — CID 23228662
bis(cyclopentane);[(1S,2R)-2-methanidyl-1-phenylbutyl]-phenylazanide;zirconium(4+) (PubChem CID 23228662) has the molecular formula C27H39NZr+2 and a molecular weight of 468.84 g/mol. Its IUPAC name is bis(cyclopentane);[(1S,2R)-2-methanidyl-1-phenylbutyl]-phenylazanide;zirconium(4+).
| Compound Name | bis(cyclopentane);[(1S,2R)-2-methanidyl-1-phenylbutyl]-phenylazanide;zirconium(4+) |
|---|---|
| PubChem CID | 23228662 |
| Molecular Formula | C27H39NZr+2 |
| Molecular Weight | 468.84 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | bis(cyclopentane);[(1S,2R)-2-methanidyl-1-phenylbutyl]-phenylazanide;zirconium(4+) |
| SMILES | C1CCCC1.C1CCCC1.[CH2-][C@H](CC)[C@H]([N-]c1ccccc1)c1ccccc1.[Zr+4] |
| InChI | InChI=1S/C17H19N.2C5H10.Zr/c1-3-14(2)17(15-10-6-4-7-11-15)18-16-12-8-5-9-13-16;2*1-2-4-5-3-1;/h4-14,17H,2-3H2,1H3;2*1-5H2;/q-2;;;+4/t14-,17+;;;/m1.../s1 |
| InChIKey | SDBRNGARMANCRO-LVVCDCQBSA-N |
| XLogP | 9.19 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.84 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|