C7H11IO4 — CID 139094887
(1R,2S,3S,6R)-4-iodo-6-methoxycyclohex-4-ene-1,2,3-triol (PubChem CID 139094887) has the molecular formula C7H11IO4 and a molecular weight of 286.07 g/mol. Its IUPAC name is (1R,2S,3S,6R)-4-iodo-6-methoxycyclohex-4-ene-1,2,3-triol.
| Compound Name | (1R,2S,3S,6R)-4-iodo-6-methoxycyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 139094887 |
| Molecular Formula | C7H11IO4 |
| Molecular Weight | 286.07 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | (1R,2S,3S,6R)-4-iodo-6-methoxycyclohex-4-ene-1,2,3-triol |
| SMILES | CO[C@@H]1C=C(I)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H11IO4/c1-12-4-2-3(8)5(9)7(11)6(4)10/h2,4-7,9-11H,1H3/t4-,5-,6+,7-/m1/s1 |
| InChIKey | QCPTZYVQBTYTFK-MVIOUDGNSA-N |
| XLogP | -0.58 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.07 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|