C7H12O4 — CID 85238693
6-methoxycyclohex-4-ene-1,2,3-triol (PubChem CID 85238693) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 6-methoxycyclohex-4-ene-1,2,3-triol.
| Compound Name | 6-methoxycyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 85238693 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 6-methoxycyclohex-4-ene-1,2,3-triol |
| SMILES | COC1C=CC(O)C(O)C1O |
| InChI | InChI=1S/C7H12O4/c1-11-5-3-2-4(8)6(9)7(5)10/h2-10H,1H3 |
| InChIKey | GAGHYDLZWMBHKQ-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|