C9H16O3 — CID 101333945
(1S,2R,5S)-5-[(2-methylpropan-2-yl)oxy]cyclopent-3-ene-1,2-diol (PubChem CID 101333945) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (1S,2R,5S)-5-[(2-methylpropan-2-yl)oxy]cyclopent-3-ene-1,2-diol.
| Compound Name | (1S,2R,5S)-5-[(2-methylpropan-2-yl)oxy]cyclopent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 101333945 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (1S,2R,5S)-5-[(2-methylpropan-2-yl)oxy]cyclopent-3-ene-1,2-diol |
| SMILES | CC(C)(C)O[C@H]1C=C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H16O3/c1-9(2,3)12-7-5-4-6(10)8(7)11/h4-8,10-11H,1-3H3/t6-,7+,8+/m1/s1 |
| InChIKey | LHNRSUIOHIGZNX-CSMHCCOUSA-N |
| XLogP | 0.46 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|