C51H39F9N6O6 — CID 139095417
2,2,2-trifluoroethyl 8-methyl-2-phenylimidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 139095417) has the molecular formula C51H39F9N6O6 and a molecular weight of 1002.89 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 8-methyl-2-phenylimidazo[1,2-a]pyridine-3-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 8-methyl-2-phenylimidazo[1,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 139095417 |
| Molecular Formula | C51H39F9N6O6 |
| Molecular Weight | 1002.89 g/mol |
| Exact Mass | 1002.28 |
| IUPAC Name | 2,2,2-trifluoroethyl 8-methyl-2-phenylimidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | Cc1cccn2c(C(=O)OCC(F)(F)F)c(-c3ccccc3)nc12.Cc1cccn2c(C(=O)OCC(F)(F)F)c(-c3ccccc3)nc12.Cc1cccn2c(C(=O)OCC(F)(F)F)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/3C17H13F3N2O2/c3*1-11-6-5-9-22-14(16(23)24-10-17(18,19)20)13(21-15(11)22)12-7-3-2-4-8-12/h3*2-9H,10H2,1H3 |
| InChIKey | RWKVNIQKDXCWNX-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 130.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1002.89 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|