C16H23F3N2O3S — CID 139097103
N-tert-butyl-3,3-dimethyl-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate (PubChem CID 139097103) has the molecular formula C16H23F3N2O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-tert-butyl-3,3-dimethyl-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate.
| Compound Name | N-tert-butyl-3,3-dimethyl-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139097103 |
| Molecular Formula | C16H23F3N2O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-tert-butyl-3,3-dimethyl-4H-isoquinolin-2-ium-1-amine;trifluoromethanesulfonate |
| SMILES | CC(C)(C)NC1=[NH+]C(C)(C)Cc2ccccc21.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C15H22N2.CHF3O3S/c1-14(2,3)16-13-12-9-7-6-8-11(12)10-15(4,5)17-13;2-1(3,4)8(5,6)7/h6-9H,10H2,1-5H3,(H,16,17);(H,5,6,7) |
| InChIKey | XYTBUYFHPSYYLN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|