C29H38BrCl2F3N2O3S — CID 139099502
2-bromo-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium;dichloromethane;trifluoromethanesulfonate (PubChem CID 139099502) has the molecular formula C29H38BrCl2F3N2O3S and a molecular weight of 702.50 g/mol. Its IUPAC name is 2-bromo-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium;dichloromethane;trifluoromethanesulfonate.
| Compound Name | 2-bromo-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium;dichloromethane;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139099502 |
| Molecular Formula | C29H38BrCl2F3N2O3S |
| Molecular Weight | 702.50 g/mol |
| Exact Mass | 700.11 |
| IUPAC Name | 2-bromo-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium;dichloromethane;trifluoromethanesulfonate |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](-c2c(C(C)C)cccc2C(C)C)c1Br.ClCCl.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C27H36BrN2.CH2Cl2.CHF3O3S/c1-17(2)21-11-9-12-22(18(3)4)25(21)29-15-16-30(27(29)28)26-23(19(5)6)13-10-14-24(26)20(7)8;2-1-3;2-1(3,4)8(5,6)7/h9-20H,1-8H3;1H2;(H,5,6,7)/q+1;;/p-1 |
| InChIKey | OXFDSEVEMMTSEJ-UHFFFAOYSA-M |
| XLogP | 9.48 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.50 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|