C55H58B2O — CID 139105726
[6-bis(2,4,6-trimethylphenyl)boranyldibenzofuran-4-yl]-bis(2,4,6-trimethylphenyl)borane;toluene (PubChem CID 139105726) has the molecular formula C55H58B2O and a molecular weight of 756.69 g/mol. Its IUPAC name is [6-bis(2,4,6-trimethylphenyl)boranyldibenzofuran-4-yl]-bis(2,4,6-trimethylphenyl)borane;toluene.
| Compound Name | [6-bis(2,4,6-trimethylphenyl)boranyldibenzofuran-4-yl]-bis(2,4,6-trimethylphenyl)borane;toluene |
|---|---|
| PubChem CID | 139105726 |
| Molecular Formula | C55H58B2O |
| Molecular Weight | 756.69 g/mol |
| Exact Mass | 756.47 |
| IUPAC Name | [6-bis(2,4,6-trimethylphenyl)boranyldibenzofuran-4-yl]-bis(2,4,6-trimethylphenyl)borane;toluene |
| SMILES | Cc1cc(C)c(B(c2c(C)cc(C)cc2C)c2cccc3c2oc2c(B(c4c(C)cc(C)cc4C)c4c(C)cc(C)cc4C)cccc23)c(C)c1.Cc1ccccc1 |
| InChI | InChI=1S/C48H50B2O.C7H8/c1-27-19-31(5)43(32(6)20-27)49(44-33(7)21-28(2)22-34(44)8)41-17-13-15-39-40-16-14-18-42(48(40)51-47(39)41)50(45-35(9)23-29(3)24-36(45)10)46-37(11)25-30(4)26-38(46)12;1-7-5-3-2-4-6-7/h13-26H,1-12H3;2-6H,1H3 |
| InChIKey | QDDRUOSIWCWZHQ-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.69 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|