C30H31BSi — CID 119078214
CID 119078214 (PubChem CID 119078214) has the molecular formula C30H31BSi and a molecular weight of 430.48 g/mol.
| Compound Name | CID 119078214 |
|---|---|
| PubChem CID | 119078214 |
| Molecular Formula | C30H31BSi |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(B(c2ccccc2[Si]c2ccccc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C30H31BSi/c1-20-16-22(3)29(23(4)17-20)31(30-24(5)18-21(2)19-25(30)6)27-14-10-11-15-28(27)32-26-12-8-7-9-13-26/h7-19H,1-6H3 |
| InChIKey | XCHVSTBRKKMULD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|