C22H26F6N6O6S2 — CID 139107984
N,N'-dimethyl-N,N'-bis(2-methylimidazo[1,5-a]pyridin-2-ium-5-yl)ethane-1,2-diamine;bis(trifluoromethanesulfonate) (PubChem CID 139107984) has the molecular formula C22H26F6N6O6S2 and a molecular weight of 648.61 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis(2-methylimidazo[1,5-a]pyridin-2-ium-5-yl)ethane-1,2-diamine;bis(trifluoromethanesulfonate).
| Compound Name | N,N'-dimethyl-N,N'-bis(2-methylimidazo[1,5-a]pyridin-2-ium-5-yl)ethane-1,2-diamine;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 139107984 |
| Molecular Formula | C22H26F6N6O6S2 |
| Molecular Weight | 648.61 g/mol |
| Exact Mass | 648.13 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis(2-methylimidazo[1,5-a]pyridin-2-ium-5-yl)ethane-1,2-diamine;bis(trifluoromethanesulfonate) |
| SMILES | CN(CCN(C)c1cccc2c[n+](C)cn12)c1cccc2c[n+](C)cn12.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C20H26N6.2CHF3O3S/c1-21-13-17-7-5-9-19(25(17)15-21)23(3)11-12-24(4)20-10-6-8-18-14-22(2)16-26(18)20;2*2-1(3,4)8(5,6)7/h5-10,13-16H,11-12H2,1-4H3;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | WGAJKVNHQKSTQC-UHFFFAOYSA-L |
| XLogP | 1.52 |
| TPSA | 137.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.61 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|