C32H32N8Si2 — CID 139110631
dimethyl-bis(pyrrolo[2,3-b]pyridin-1-yl)silane (PubChem CID 139110631) has the molecular formula C32H32N8Si2 and a molecular weight of 584.84 g/mol. Its IUPAC name is dimethyl-bis(pyrrolo[2,3-b]pyridin-1-yl)silane.
| Compound Name | dimethyl-bis(pyrrolo[2,3-b]pyridin-1-yl)silane |
|---|---|
| PubChem CID | 139110631 |
| Molecular Formula | C32H32N8Si2 |
| Molecular Weight | 584.84 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | dimethyl-bis(pyrrolo[2,3-b]pyridin-1-yl)silane |
| SMILES | C[Si](C)(n1ccc2cccnc21)n1ccc2cccnc21.C[Si](C)(n1ccc2cccnc21)n1ccc2cccnc21 |
| InChI | InChI=1S/2C16H16N4Si/c2*1-21(2,19-11-7-13-5-3-9-17-15(13)19)20-12-8-14-6-4-10-18-16(14)20/h2*3-12H,1-2H3 |
| InChIKey | NXULPTCDBBNSMW-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 71.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.84 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|