C39H27BiN6 — CID 138972796
tris(4-pyrrolo[2,3-b]pyridin-1-ylphenyl)bismuthane (PubChem CID 138972796) has the molecular formula C39H27BiN6 and a molecular weight of 788.67 g/mol. Its IUPAC name is tris(4-pyrrolo[2,3-b]pyridin-1-ylphenyl)bismuthane.
| Compound Name | tris(4-pyrrolo[2,3-b]pyridin-1-ylphenyl)bismuthane |
|---|---|
| PubChem CID | 138972796 |
| Molecular Formula | C39H27BiN6 |
| Molecular Weight | 788.67 g/mol |
| Exact Mass | 788.21 |
| IUPAC Name | tris(4-pyrrolo[2,3-b]pyridin-1-ylphenyl)bismuthane |
| SMILES | c1cnc2c(c1)ccn2-c1ccc([Bi](c2ccc(-n3ccc4cccnc43)cc2)c2ccc(-n3ccc4cccnc43)cc2)cc1 |
| InChI | InChI=1S/3C13H9N2.Bi/c3*1-2-6-12(7-3-1)15-10-8-11-5-4-9-14-13(11)15;/h3*2-10H; |
| InChIKey | YDWLQUMAULMLIR-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |