C11H7N3O2 — CID 119085561
3-pyrrolo[2,3-b]pyridin-1-ylpyrrole-2,5-dione (PubChem CID 119085561) has the molecular formula C11H7N3O2 and a molecular weight of 213.20 g/mol. Its IUPAC name is 3-pyrrolo[2,3-b]pyridin-1-ylpyrrole-2,5-dione.
| Compound Name | 3-pyrrolo[2,3-b]pyridin-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 119085561 |
| Molecular Formula | C11H7N3O2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 3-pyrrolo[2,3-b]pyridin-1-ylpyrrole-2,5-dione |
| SMILES | O=C1C=C(n2ccc3cccnc32)C(=O)N1 |
| InChI | InChI=1S/C11H7N3O2/c15-9-6-8(11(16)13-9)14-5-3-7-2-1-4-12-10(7)14/h1-6H,(H,13,15,16) |
| InChIKey | RJDUTMGBNAAQNJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|